C14H19BrO3S — CID 23466497
4-bromo-2-hept-6-enylsulfonyl-1-methoxybenzene (PubChem CID 23466497) has the molecular formula C14H19BrO3S and a molecular weight of 347.27 g/mol. Its IUPAC name is 4-bromo-2-hept-6-enylsulfonyl-1-methoxybenzene.
| Compound Name | 4-bromo-2-hept-6-enylsulfonyl-1-methoxybenzene |
|---|---|
| PubChem CID | 23466497 |
| Molecular Formula | C14H19BrO3S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 4-bromo-2-hept-6-enylsulfonyl-1-methoxybenzene |
| SMILES | C=CCCCCCS(=O)(=O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C14H19BrO3S/c1-3-4-5-6-7-10-19(16,17)14-11-12(15)8-9-13(14)18-2/h3,8-9,11H,1,4-7,10H2,2H3 |
| InChIKey | INHUYPDFGBTZJN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|