C16H22O4S — CID 107007621
5-hept-6-enylsulfonyl-2,4-dimethylbenzoic acid (PubChem CID 107007621) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is 5-hept-6-enylsulfonyl-2,4-dimethylbenzoic acid.
| Compound Name | 5-hept-6-enylsulfonyl-2,4-dimethylbenzoic acid |
|---|---|
| PubChem CID | 107007621 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 5-hept-6-enylsulfonyl-2,4-dimethylbenzoic acid |
| SMILES | C=CCCCCCS(=O)(=O)c1cc(C(=O)O)c(C)cc1C |
| InChI | InChI=1S/C16H22O4S/c1-4-5-6-7-8-9-21(19,20)15-11-14(16(17)18)12(2)10-13(15)3/h4,10-11H,1,5-9H2,2-3H3,(H,17,18) |
| InChIKey | WMCPYPGDVJYNOR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|