C12H15NO5S — CID 43316974
2,4-dimethyl-5-[2-(methylamino)-2-oxoethyl]sulfonylbenzoic acid (PubChem CID 43316974) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2,4-dimethyl-5-[2-(methylamino)-2-oxoethyl]sulfonylbenzoic acid.
| Compound Name | 2,4-dimethyl-5-[2-(methylamino)-2-oxoethyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 43316974 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2,4-dimethyl-5-[2-(methylamino)-2-oxoethyl]sulfonylbenzoic acid |
| SMILES | CNC(=O)CS(=O)(=O)c1cc(C(=O)O)c(C)cc1C |
| InChI | InChI=1S/C12H15NO5S/c1-7-4-8(2)10(5-9(7)12(15)16)19(17,18)6-11(14)13-3/h4-5H,6H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | MHHGRVQICHQNQL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |