C12H18O3S — CID 116853215
3-(2,4,5-trimethylphenyl)sulfonylpropan-1-ol (PubChem CID 116853215) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is 3-(2,4,5-trimethylphenyl)sulfonylpropan-1-ol.
| Compound Name | 3-(2,4,5-trimethylphenyl)sulfonylpropan-1-ol |
|---|---|
| PubChem CID | 116853215 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 3-(2,4,5-trimethylphenyl)sulfonylpropan-1-ol |
| SMILES | Cc1cc(C)c(S(=O)(=O)CCCO)cc1C |
| InChI | InChI=1S/C12H18O3S/c1-9-7-11(3)12(8-10(9)2)16(14,15)6-4-5-13/h7-8,13H,4-6H2,1-3H3 |
| InChIKey | VYMUTLXRHBITEQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |