C10H13BrO3S — CID 116853238
3-(5-bromo-2-methylphenyl)sulfonylpropan-1-ol (PubChem CID 116853238) has the molecular formula C10H13BrO3S and a molecular weight of 293.18 g/mol. Its IUPAC name is 3-(5-bromo-2-methylphenyl)sulfonylpropan-1-ol.
| Compound Name | 3-(5-bromo-2-methylphenyl)sulfonylpropan-1-ol |
|---|---|
| PubChem CID | 116853238 |
| Molecular Formula | C10H13BrO3S |
| Molecular Weight | 293.18 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 3-(5-bromo-2-methylphenyl)sulfonylpropan-1-ol |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)CCCO |
| InChI | InChI=1S/C10H13BrO3S/c1-8-3-4-9(11)7-10(8)15(13,14)6-2-5-12/h3-4,7,12H,2,5-6H2,1H3 |
| InChIKey | BHRFRHDEDNUDPQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |