C10H11NO3S — CID 138630803
3-(2-hydroxyethylsulfonyl)-4-methylbenzonitrile (PubChem CID 138630803) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is 3-(2-hydroxyethylsulfonyl)-4-methylbenzonitrile.
| Compound Name | 3-(2-hydroxyethylsulfonyl)-4-methylbenzonitrile |
|---|---|
| PubChem CID | 138630803 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 3-(2-hydroxyethylsulfonyl)-4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)cc1S(=O)(=O)CCO |
| InChI | InChI=1S/C10H11NO3S/c1-8-2-3-9(7-11)6-10(8)15(13,14)5-4-12/h2-3,6,12H,4-5H2,1H3 |
| InChIKey | NHYOOWUGLKCTDO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |