C11H13BrN2O2S — CID 106441867
N-(2-bromoethyl)-5-cyano-N,2-dimethylbenzenesulfonamide (PubChem CID 106441867) has the molecular formula C11H13BrN2O2S and a molecular weight of 317.21 g/mol. Its IUPAC name is N-(2-bromoethyl)-5-cyano-N,2-dimethylbenzenesulfonamide.
| Compound Name | N-(2-bromoethyl)-5-cyano-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106441867 |
| Molecular Formula | C11H13BrN2O2S |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | N-(2-bromoethyl)-5-cyano-N,2-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C#N)cc1S(=O)(=O)N(C)CCBr |
| InChI | InChI=1S/C11H13BrN2O2S/c1-9-3-4-10(8-13)7-11(9)17(15,16)14(2)6-5-12/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | YTIOFILFCKTPBQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|