C14H20N2O2S — CID 106997235
4-cyano-N,2-dimethyl-N-pentylbenzenesulfonamide (PubChem CID 106997235) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 4-cyano-N,2-dimethyl-N-pentylbenzenesulfonamide.
| Compound Name | 4-cyano-N,2-dimethyl-N-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 106997235 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-cyano-N,2-dimethyl-N-pentylbenzenesulfonamide |
| SMILES | CCCCCN(C)S(=O)(=O)c1ccc(C#N)cc1C |
| InChI | InChI=1S/C14H20N2O2S/c1-4-5-6-9-16(3)19(17,18)14-8-7-13(11-15)10-12(14)2/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | KGBYGMOSJFZAHS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|