C12H20N2O2S — CID 43258018
4-amino-N-butyl-N,2-dimethylbenzenesulfonamide (PubChem CID 43258018) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 4-amino-N-butyl-N,2-dimethylbenzenesulfonamide.
| Compound Name | 4-amino-N-butyl-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43258018 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-amino-N-butyl-N,2-dimethylbenzenesulfonamide |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc(N)cc1C |
| InChI | InChI=1S/C12H20N2O2S/c1-4-5-8-14(3)17(15,16)12-7-6-11(13)9-10(12)2/h6-7,9H,4-5,8,13H2,1-3H3 |
| InChIKey | BZYUBIMIKMFSMU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|