C11H18N2O2S2 — CID 112656554
4-amino-N,2-dimethyl-N-(2-methylsulfanylethyl)benzenesulfonamide (PubChem CID 112656554) has the molecular formula C11H18N2O2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is 4-amino-N,2-dimethyl-N-(2-methylsulfanylethyl)benzenesulfonamide.
| Compound Name | 4-amino-N,2-dimethyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 112656554 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-amino-N,2-dimethyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
| SMILES | CSCCN(C)S(=O)(=O)c1ccc(N)cc1C |
| InChI | InChI=1S/C11H18N2O2S2/c1-9-8-10(12)4-5-11(9)17(14,15)13(2)6-7-16-3/h4-5,8H,6-7,12H2,1-3H3 |
| InChIKey | RJLYAPPKDOXFEG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|