C10H14F2N2O2S2 — CID 112656575
5-amino-2,4-difluoro-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide (PubChem CID 112656575) has the molecular formula C10H14F2N2O2S2 and a molecular weight of 296.36 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide.
| Compound Name | 5-amino-2,4-difluoro-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 112656575 |
| Molecular Formula | C10H14F2N2O2S2 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 5-amino-2,4-difluoro-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
| SMILES | CSCCN(C)S(=O)(=O)c1cc(N)c(F)cc1F |
| InChI | InChI=1S/C10H14F2N2O2S2/c1-14(3-4-17-2)18(15,16)10-6-9(13)7(11)5-8(10)12/h5-6H,3-4,13H2,1-2H3 |
| InChIKey | SOYAYJHXGFPCFJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|