C11H14ClF2NO2S2 — CID 105118487
5-(chloromethyl)-2,3-difluoro-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide (PubChem CID 105118487) has the molecular formula C11H14ClF2NO2S2 and a molecular weight of 329.82 g/mol. Its IUPAC name is 5-(chloromethyl)-2,3-difluoro-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide.
| Compound Name | 5-(chloromethyl)-2,3-difluoro-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 105118487 |
| Molecular Formula | C11H14ClF2NO2S2 |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 5-(chloromethyl)-2,3-difluoro-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
| SMILES | CSCCN(C)S(=O)(=O)c1cc(CCl)cc(F)c1F |
| InChI | InChI=1S/C11H14ClF2NO2S2/c1-15(3-4-18-2)19(16,17)10-6-8(7-12)5-9(13)11(10)14/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | HQVGCLIBLWOOBS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|