C13H20ClNO3S2 — CID 115988176
2-(2-chloroethyl)-4-methoxy-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide (PubChem CID 115988176) has the molecular formula C13H20ClNO3S2 and a molecular weight of 337.89 g/mol. Its IUPAC name is 2-(2-chloroethyl)-4-methoxy-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide.
| Compound Name | 2-(2-chloroethyl)-4-methoxy-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115988176 |
| Molecular Formula | C13H20ClNO3S2 |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 2-(2-chloroethyl)-4-methoxy-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CCSC)c(CCCl)c1 |
| InChI | InChI=1S/C13H20ClNO3S2/c1-15(8-9-19-3)20(16,17)13-5-4-12(18-2)10-11(13)6-7-14/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | NTWHSMAWFMYQCR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|