C11H17BrN2O2S2 — CID 112667211
4-(aminomethyl)-2-bromo-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide (PubChem CID 112667211) has the molecular formula C11H17BrN2O2S2 and a molecular weight of 353.31 g/mol. Its IUPAC name is 4-(aminomethyl)-2-bromo-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide.
| Compound Name | 4-(aminomethyl)-2-bromo-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 112667211 |
| Molecular Formula | C11H17BrN2O2S2 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 4-(aminomethyl)-2-bromo-N-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
| SMILES | CSCCN(C)S(=O)(=O)c1ccc(CN)cc1Br |
| InChI | InChI=1S/C11H17BrN2O2S2/c1-14(5-6-17-2)18(15,16)11-4-3-9(8-13)7-10(11)12/h3-4,7H,5-6,8,13H2,1-2H3 |
| InChIKey | ROLDKZVOGYVUIP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |