C7H14N4O2S2 — CID 112656604
5-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 112656604) has the molecular formula C7H14N4O2S2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 5-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 112656604 |
| Molecular Formula | C7H14N4O2S2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-amino-N-methyl-N-(2-methylsulfanylethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CSCCN(C)S(=O)(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C7H14N4O2S2/c1-11(3-4-14-2)15(12,13)6-5-9-10-7(6)8/h5H,3-4H2,1-2H3,(H3,8,9,10) |
| InChIKey | NBKGJZCOJRNUOF-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |