C9H18N4O2S — CID 60808130
5-amino-N-methyl-N-(2-methylbutyl)-1H-pyrazole-4-sulfonamide (PubChem CID 60808130) has the molecular formula C9H18N4O2S and a molecular weight of 246.34 g/mol. Its IUPAC name is 5-amino-N-methyl-N-(2-methylbutyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-methyl-N-(2-methylbutyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60808130 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 5-amino-N-methyl-N-(2-methylbutyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CCC(C)CN(C)S(=O)(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C9H18N4O2S/c1-4-7(2)6-13(3)16(14,15)8-5-11-12-9(8)10/h5,7H,4,6H2,1-3H3,(H3,10,11,12) |
| InChIKey | OMDDQXTYWYKYSA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |