C8H15N3O2S — CID 107766279
4-(2-methylbutylsulfonyl)-1H-pyrazol-5-amine (PubChem CID 107766279) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 4-(2-methylbutylsulfonyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(2-methylbutylsulfonyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 107766279 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 4-(2-methylbutylsulfonyl)-1H-pyrazol-5-amine |
| SMILES | CCC(C)CS(=O)(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C8H15N3O2S/c1-3-6(2)5-14(12,13)7-4-10-11-8(7)9/h4,6H,3,5H2,1-2H3,(H3,9,10,11) |
| InChIKey | BSGABFMBXXJELP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |