C11H22N4O2S — CID 61108156
5-amino-N-(6-methylheptan-2-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 61108156) has the molecular formula C11H22N4O2S and a molecular weight of 274.39 g/mol. Its IUPAC name is 5-amino-N-(6-methylheptan-2-yl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-(6-methylheptan-2-yl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61108156 |
| Molecular Formula | C11H22N4O2S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 5-amino-N-(6-methylheptan-2-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | CC(C)CCCC(C)NS(=O)(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C11H22N4O2S/c1-8(2)5-4-6-9(3)15-18(16,17)10-7-13-14-11(10)12/h7-9,15H,4-6H2,1-3H3,(H3,12,13,14) |
| InChIKey | BRRGMPJAABLEDG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |