C8H16N4O2S — CID 60810253
5-amino-N-(3-methylbutan-2-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 60810253) has the molecular formula C8H16N4O2S and a molecular weight of 232.31 g/mol. Its IUPAC name is 5-amino-N-(3-methylbutan-2-yl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-(3-methylbutan-2-yl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60810253 |
| Molecular Formula | C8H16N4O2S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 5-amino-N-(3-methylbutan-2-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | CC(C)C(C)NS(=O)(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C8H16N4O2S/c1-5(2)6(3)12-15(13,14)7-4-10-11-8(7)9/h4-6,12H,1-3H3,(H3,9,10,11) |
| InChIKey | VYLQDTMMPCBOBA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |