C11H14N4O3S — CID 55160188
5-amino-N-(2-hydroxy-1-phenylethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 55160188) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is 5-amino-N-(2-hydroxy-1-phenylethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-(2-hydroxy-1-phenylethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 55160188 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 5-amino-N-(2-hydroxy-1-phenylethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Nc1[nH]ncc1S(=O)(=O)NC(CO)c1ccccc1 |
| InChI | InChI=1S/C11H14N4O3S/c12-11-10(6-13-14-11)19(17,18)15-9(7-16)8-4-2-1-3-5-8/h1-6,9,15-16H,7H2,(H3,12,13,14) |
| InChIKey | HMHDCJVSORHELU-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |