C10H19N3O2S — CID 60959000
N,5-dimethyl-N-(3-methylbutyl)-1H-pyrazole-4-sulfonamide (PubChem CID 60959000) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is N,5-dimethyl-N-(3-methylbutyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N,5-dimethyl-N-(3-methylbutyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60959000 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N,5-dimethyl-N-(3-methylbutyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)N(C)CCC(C)C |
| InChI | InChI=1S/C10H19N3O2S/c1-8(2)5-6-13(4)16(14,15)10-7-11-12-9(10)3/h7-8H,5-6H2,1-4H3,(H,11,12) |
| InChIKey | PJDNIYDJIOGVGQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |