C10H17N3O2S — CID 115640454
N,5-dimethyl-N-pent-4-enyl-1H-pyrazole-4-sulfonamide (PubChem CID 115640454) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is N,5-dimethyl-N-pent-4-enyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N,5-dimethyl-N-pent-4-enyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115640454 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N,5-dimethyl-N-pent-4-enyl-1H-pyrazole-4-sulfonamide |
| SMILES | C=CCCCN(C)S(=O)(=O)c1cn[nH]c1C |
| InChI | InChI=1S/C10H17N3O2S/c1-4-5-6-7-13(3)16(14,15)10-8-11-12-9(10)2/h4,8H,1,5-7H2,2-3H3,(H,11,12) |
| InChIKey | MJSTYRFKOVXGCZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|