C10H13N3O3S — CID 54929638
N-(furan-2-ylmethyl)-N,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 54929638) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-N,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 54929638 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N-(furan-2-ylmethyl)-N,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)N(C)Cc1ccco1 |
| InChI | InChI=1S/C10H13N3O3S/c1-8-10(6-11-12-8)17(14,15)13(2)7-9-4-3-5-16-9/h3-6H,7H2,1-2H3,(H,11,12) |
| InChIKey | HHBYGSRATRLATL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |