C16H21NO3S — CID 7937948
N-(furan-2-ylmethyl)-N,2,3,5,6-pentamethylbenzenesulfonamide (PubChem CID 7937948) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N,2,3,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-N,2,3,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 7937948 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-N,2,3,5,6-pentamethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N(C)Cc2ccco2)c1C |
| InChI | InChI=1S/C16H21NO3S/c1-11-9-12(2)14(4)16(13(11)3)21(18,19)17(5)10-15-7-6-8-20-15/h6-9H,10H2,1-5H3 |
| InChIKey | IGJVHGLFVRPVDE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |