C9H19N5O2S — CID 63693578
5-amino-N-[3-(dimethylamino)propyl]-N-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 63693578) has the molecular formula C9H19N5O2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 5-amino-N-[3-(dimethylamino)propyl]-N-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-[3-(dimethylamino)propyl]-N-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 63693578 |
| Molecular Formula | C9H19N5O2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 5-amino-N-[3-(dimethylamino)propyl]-N-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | CN(C)CCCN(C)S(=O)(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C9H19N5O2S/c1-13(2)5-4-6-14(3)17(15,16)8-7-11-12-9(8)10/h7H,4-6H2,1-3H3,(H3,10,11,12) |
| InChIKey | NVWOEVDJAURMJZ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |