C11H12ClFN4O2S — CID 61127334
5-amino-N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 61127334) has the molecular formula C11H12ClFN4O2S and a molecular weight of 318.76 g/mol. Its IUPAC name is 5-amino-N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61127334 |
| Molecular Formula | C11H12ClFN4O2S |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 5-amino-N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | CN(Cc1c(F)cccc1Cl)S(=O)(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C11H12ClFN4O2S/c1-17(6-7-8(12)3-2-4-9(7)13)20(18,19)10-5-15-16-11(10)14/h2-5H,6H2,1H3,(H3,14,15,16) |
| InChIKey | YGTSCFNMECBABS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |