C12H10Cl2FN3O — CID 18095470
5-chloro-4-[(2-chloro-6-fluorophenyl)methyl-methylamino]-1H-pyridazin-6-one (PubChem CID 18095470) has the molecular formula C12H10Cl2FN3O and a molecular weight of 302.14 g/mol. Its IUPAC name is 5-chloro-4-[(2-chloro-6-fluorophenyl)methyl-methylamino]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[(2-chloro-6-fluorophenyl)methyl-methylamino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 18095470 |
| Molecular Formula | C12H10Cl2FN3O |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 5-chloro-4-[(2-chloro-6-fluorophenyl)methyl-methylamino]-1H-pyridazin-6-one |
| SMILES | CN(Cc1c(F)cccc1Cl)c1cn[nH]c(=O)c1Cl |
| InChI | InChI=1S/C12H10Cl2FN3O/c1-18(10-5-16-17-12(19)11(10)14)6-7-8(13)3-2-4-9(7)15/h2-5H,6H2,1H3,(H,17,19) |
| InChIKey | RJFHWOSNRQNSFD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |