C12H13N5O2S — CID 61111809
5-amino-N-[(3-cyanophenyl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 61111809) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 5-amino-N-[(3-cyanophenyl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-[(3-cyanophenyl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61111809 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 5-amino-N-[(3-cyanophenyl)methyl]-N-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | CN(Cc1cccc(C#N)c1)S(=O)(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C12H13N5O2S/c1-17(8-10-4-2-3-9(5-10)6-13)20(18,19)11-7-15-16-12(11)14/h2-5,7H,8H2,1H3,(H3,14,15,16) |
| InChIKey | AEIYEYQRXKLDSV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |