C13H17ClN2O2S — CID 116815295
4-chloro-N-[(3-cyanophenyl)methyl]-N-methylbutane-1-sulfonamide (PubChem CID 116815295) has the molecular formula C13H17ClN2O2S and a molecular weight of 300.81 g/mol. Its IUPAC name is 4-chloro-N-[(3-cyanophenyl)methyl]-N-methylbutane-1-sulfonamide.
| Compound Name | 4-chloro-N-[(3-cyanophenyl)methyl]-N-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 116815295 |
| Molecular Formula | C13H17ClN2O2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-chloro-N-[(3-cyanophenyl)methyl]-N-methylbutane-1-sulfonamide |
| SMILES | CN(Cc1cccc(C#N)c1)S(=O)(=O)CCCCCl |
| InChI | InChI=1S/C13H17ClN2O2S/c1-16(19(17,18)8-3-2-7-14)11-13-6-4-5-12(9-13)10-15/h4-6,9H,2-3,7-8,11H2,1H3 |
| InChIKey | MZPLGCUNXHXYBB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|