C11H14ClF2NO2S — CID 54877367
3-chloro-N-[(3,4-difluorophenyl)methyl]-N-methylpropane-1-sulfonamide (PubChem CID 54877367) has the molecular formula C11H14ClF2NO2S and a molecular weight of 297.75 g/mol. Its IUPAC name is 3-chloro-N-[(3,4-difluorophenyl)methyl]-N-methylpropane-1-sulfonamide.
| Compound Name | 3-chloro-N-[(3,4-difluorophenyl)methyl]-N-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 54877367 |
| Molecular Formula | C11H14ClF2NO2S |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 3-chloro-N-[(3,4-difluorophenyl)methyl]-N-methylpropane-1-sulfonamide |
| SMILES | CN(Cc1ccc(F)c(F)c1)S(=O)(=O)CCCCl |
| InChI | InChI=1S/C11H14ClF2NO2S/c1-15(18(16,17)6-2-5-12)8-9-3-4-10(13)11(14)7-9/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | LLVNDUZMEBSQHO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|