C10H16ClNO3S — CID 116816025
4-chloro-N-(furan-3-ylmethyl)-N-methylbutane-1-sulfonamide (PubChem CID 116816025) has the molecular formula C10H16ClNO3S and a molecular weight of 265.76 g/mol. Its IUPAC name is 4-chloro-N-(furan-3-ylmethyl)-N-methylbutane-1-sulfonamide.
| Compound Name | 4-chloro-N-(furan-3-ylmethyl)-N-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 116816025 |
| Molecular Formula | C10H16ClNO3S |
| Molecular Weight | 265.76 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 4-chloro-N-(furan-3-ylmethyl)-N-methylbutane-1-sulfonamide |
| SMILES | CN(Cc1ccoc1)S(=O)(=O)CCCCCl |
| InChI | InChI=1S/C10H16ClNO3S/c1-12(8-10-4-6-15-9-10)16(13,14)7-3-2-5-11/h4,6,9H,2-3,5,7-8H2,1H3 |
| InChIKey | NBBLFZUFHRRVTA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.76 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|