C9H14ClNO — CID 61422654
3-chloro-N-(furan-3-ylmethyl)-N-methylpropan-1-amine (PubChem CID 61422654) has the molecular formula C9H14ClNO and a molecular weight of 187.67 g/mol. Its IUPAC name is 3-chloro-N-(furan-3-ylmethyl)-N-methylpropan-1-amine.
| Compound Name | 3-chloro-N-(furan-3-ylmethyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 61422654 |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 3-chloro-N-(furan-3-ylmethyl)-N-methylpropan-1-amine |
| SMILES | CN(CCCCl)Cc1ccoc1 |
| InChI | InChI=1S/C9H14ClNO/c1-11(5-2-4-10)7-9-3-6-12-8-9/h3,6,8H,2,4-5,7H2,1H3 |
| InChIKey | QOBNKFVGPXLRHA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|