C10H17NO3 — CID 66224056
N-(furan-3-ylmethyl)-2,2-dimethoxy-N-methylethanamine (PubChem CID 66224056) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-2,2-dimethoxy-N-methylethanamine.
| Compound Name | N-(furan-3-ylmethyl)-2,2-dimethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 66224056 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | N-(furan-3-ylmethyl)-2,2-dimethoxy-N-methylethanamine |
| SMILES | COC(CN(C)Cc1ccoc1)OC |
| InChI | InChI=1S/C10H17NO3/c1-11(7-10(12-2)13-3)6-9-4-5-14-8-9/h4-5,8,10H,6-7H2,1-3H3 |
| InChIKey | VLPWLAFSDSNDMH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|