C10H15NOS — CID 103073397
2-[[furan-3-ylmethyl(methyl)amino]methyl]prop-2-ene-1-thiol (PubChem CID 103073397) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is 2-[[furan-3-ylmethyl(methyl)amino]methyl]prop-2-ene-1-thiol.
| Compound Name | 2-[[furan-3-ylmethyl(methyl)amino]methyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103073397 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-[[furan-3-ylmethyl(methyl)amino]methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN(C)Cc1ccoc1 |
| InChI | InChI=1S/C10H15NOS/c1-9(8-13)5-11(2)6-10-3-4-12-7-10/h3-4,7,13H,1,5-6,8H2,2H3 |
| InChIKey | VFIBKGMAJSTWNA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 16.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|