C11H13N3O4S — CID 115874261
methyl N-[(3-cyanophenyl)methyl-methylsulfamoyl]carbamate (PubChem CID 115874261) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is methyl N-[(3-cyanophenyl)methyl-methylsulfamoyl]carbamate.
| Compound Name | methyl N-[(3-cyanophenyl)methyl-methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 115874261 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | methyl N-[(3-cyanophenyl)methyl-methylsulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)N(C)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C11H13N3O4S/c1-14(19(16,17)13-11(15)18-2)8-10-5-3-4-9(6-10)7-12/h3-6H,8H2,1-2H3,(H,13,15) |
| InChIKey | JOEFSPQKUCZWRS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |