C12H15N3O — CID 112726627
1-[(3-cyanophenyl)methyl]-1,3,3-trimethylurea (PubChem CID 112726627) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-1,3,3-trimethylurea.
| Compound Name | 1-[(3-cyanophenyl)methyl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 112726627 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C12H15N3O/c1-14(2)12(16)15(3)9-11-6-4-5-10(7-11)8-13/h4-7H,9H2,1-3H3 |
| InChIKey | ZNAZFGFQGIRYIY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |