C15H20N2O2 — CID 79154096
1-[[3-(4-hydroxybut-1-ynyl)phenyl]methyl]-1,3,3-trimethylurea (PubChem CID 79154096) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-[[3-(4-hydroxybut-1-ynyl)phenyl]methyl]-1,3,3-trimethylurea.
| Compound Name | 1-[[3-(4-hydroxybut-1-ynyl)phenyl]methyl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 79154096 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-[[3-(4-hydroxybut-1-ynyl)phenyl]methyl]-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)Cc1cccc(C#CCCO)c1 |
| InChI | InChI=1S/C15H20N2O2/c1-16(2)15(19)17(3)12-14-9-6-8-13(11-14)7-4-5-10-18/h6,8-9,11,18H,5,10,12H2,1-3H3 |
| InChIKey | ZWXAXWZTSVODGN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|