C16H22N2O2 — CID 79162479
1-ethyl-3-[[3-(4-hydroxybut-1-ynyl)phenyl]methyl]-1,3-dimethylurea (PubChem CID 79162479) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-ethyl-3-[[3-(4-hydroxybut-1-ynyl)phenyl]methyl]-1,3-dimethylurea.
| Compound Name | 1-ethyl-3-[[3-(4-hydroxybut-1-ynyl)phenyl]methyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 79162479 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-ethyl-3-[[3-(4-hydroxybut-1-ynyl)phenyl]methyl]-1,3-dimethylurea |
| SMILES | CCN(C)C(=O)N(C)Cc1cccc(C#CCCO)c1 |
| InChI | InChI=1S/C16H22N2O2/c1-4-17(2)16(20)18(3)13-15-10-7-9-14(12-15)8-5-6-11-19/h7,9-10,12,19H,4,6,11,13H2,1-3H3 |
| InChIKey | BAQQYZGIZOWFCA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|