C14H19N3O — CID 79154209
1-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]-1,3,3-trimethylurea (PubChem CID 79154209) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 1-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]-1,3,3-trimethylurea.
| Compound Name | 1-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 79154209 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 1-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)Cc1cccc(C#CCN)c1 |
| InChI | InChI=1S/C14H19N3O/c1-16(2)14(18)17(3)11-13-7-4-6-12(10-13)8-5-9-15/h4,6-7,10H,9,11,15H2,1-3H3 |
| InChIKey | VNBTVVXLQQICBD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|