C14H18N2O — CID 60821032
3-(3-aminoprop-1-ynyl)-N,N-diethylbenzamide (PubChem CID 60821032) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N,N-diethylbenzamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 60821032 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(C#CCN)c1 |
| InChI | InChI=1S/C14H18N2O/c1-3-16(4-2)14(17)13-9-5-7-12(11-13)8-6-10-15/h5,7,9,11H,3-4,10,15H2,1-2H3 |
| InChIKey | DWMSLGXNLRNDFP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|