C14H12N4O — CID 54921681
3-(3-aminoprop-1-ynyl)-N,N-bis(cyanomethyl)benzamide (PubChem CID 54921681) has the molecular formula C14H12N4O and a molecular weight of 252.28 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N,N-bis(cyanomethyl)benzamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N,N-bis(cyanomethyl)benzamide |
|---|---|
| PubChem CID | 54921681 |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N,N-bis(cyanomethyl)benzamide |
| SMILES | N#CCN(CC#N)C(=O)c1cccc(C#CCN)c1 |
| InChI | InChI=1S/C14H12N4O/c15-6-2-4-12-3-1-5-13(11-12)14(19)18(9-7-16)10-8-17/h1,3,5,11H,6,9-10,15H2 |
| InChIKey | ZZPOQIZZWWLDDQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 93.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|