C13H16N2O2 — CID 79154315
3-[3-(4-hydroxybut-1-ynyl)phenyl]-1,1-dimethylurea (PubChem CID 79154315) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-[3-(4-hydroxybut-1-ynyl)phenyl]-1,1-dimethylurea.
| Compound Name | 3-[3-(4-hydroxybut-1-ynyl)phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 79154315 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-[3-(4-hydroxybut-1-ynyl)phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1cccc(C#CCCO)c1 |
| InChI | InChI=1S/C13H16N2O2/c1-15(2)13(17)14-12-8-5-7-11(10-12)6-3-4-9-16/h5,7-8,10,16H,4,9H2,1-2H3,(H,14,17) |
| InChIKey | WZJRJKBLUDLXPN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|