C14H17NO3 — CID 60803360
2-ethoxy-N-[3-(4-hydroxybut-1-ynyl)phenyl]acetamide (PubChem CID 60803360) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-ethoxy-N-[3-(4-hydroxybut-1-ynyl)phenyl]acetamide.
| Compound Name | 2-ethoxy-N-[3-(4-hydroxybut-1-ynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 60803360 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-ethoxy-N-[3-(4-hydroxybut-1-ynyl)phenyl]acetamide |
| SMILES | CCOCC(=O)Nc1cccc(C#CCCO)c1 |
| InChI | InChI=1S/C14H17NO3/c1-2-18-11-14(17)15-13-8-5-7-12(10-13)6-3-4-9-16/h5,7-8,10,16H,2,4,9,11H2,1H3,(H,15,17) |
| InChIKey | RCPUFUMUBMXUMK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|