C17H15NO3 — CID 60813714
phenyl N-[3-(4-hydroxybut-1-ynyl)phenyl]carbamate (PubChem CID 60813714) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is phenyl N-[3-(4-hydroxybut-1-ynyl)phenyl]carbamate.
| Compound Name | phenyl N-[3-(4-hydroxybut-1-ynyl)phenyl]carbamate |
|---|---|
| PubChem CID | 60813714 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | phenyl N-[3-(4-hydroxybut-1-ynyl)phenyl]carbamate |
| SMILES | O=C(Nc1cccc(C#CCCO)c1)Oc1ccccc1 |
| InChI | InChI=1S/C17H15NO3/c19-12-5-4-7-14-8-6-9-15(13-14)18-17(20)21-16-10-2-1-3-11-16/h1-3,6,8-11,13,19H,5,12H2,(H,18,20) |
| InChIKey | IJGINSWSVPUCKV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|