C19H14N4O2 — CID 11336469
phenyl N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]carbamate (PubChem CID 11336469) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is phenyl N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]carbamate.
| Compound Name | phenyl N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]carbamate |
|---|---|
| PubChem CID | 11336469 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | phenyl N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]carbamate |
| SMILES | Nc1ncc(C#Cc2cccc(NC(=O)Oc3ccccc3)c2)cn1 |
| InChI | InChI=1S/C19H14N4O2/c20-18-21-12-15(13-22-18)10-9-14-5-4-6-16(11-14)23-19(24)25-17-7-2-1-3-8-17/h1-8,11-13H,(H,23,24)(H2,20,21,22) |
| InChIKey | FATFFXNQTXKWKM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|