C25H26N6O — CID 59198271
1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-3-(1-phenyl-2-pyrrolidin-1-ylethyl)urea (PubChem CID 59198271) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-3-(1-phenyl-2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-3-(1-phenyl-2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 59198271 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-3-(1-phenyl-2-pyrrolidin-1-ylethyl)urea |
| SMILES | Nc1ncc(C#Cc2cccc(NC(=O)NC(CN3CCCC3)c3ccccc3)c2)cn1 |
| InChI | InChI=1S/C25H26N6O/c26-24-27-16-20(17-28-24)12-11-19-7-6-10-22(15-19)29-25(32)30-23(18-31-13-4-5-14-31)21-8-2-1-3-9-21/h1-3,6-10,15-17,23H,4-5,13-14,18H2,(H2,26,27,28)(H2,29,30,32) |
| InChIKey | DXCVEOFEHFZBEH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|