C13H10N4O2 — CID 68700778
[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]carbamic acid (PubChem CID 68700778) has the molecular formula C13H10N4O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is [3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]carbamic acid.
| Compound Name | [3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 68700778 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | [3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]carbamic acid |
| SMILES | Nc1ncc(C#Cc2cccc(NC(=O)O)c2)cn1 |
| InChI | InChI=1S/C13H10N4O2/c14-12-15-7-10(8-16-12)5-4-9-2-1-3-11(6-9)17-13(18)19/h1-3,6-8,17H,(H,18,19)(H2,14,15,16) |
| InChIKey | BFBUCAHPTZXPGJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|