C20H15F3N6O — CID 68887828
1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-1-[3-(trifluoromethyl)anilino]urea (PubChem CID 68887828) has the molecular formula C20H15F3N6O and a molecular weight of 412.38 g/mol. Its IUPAC name is 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-1-[3-(trifluoromethyl)anilino]urea.
| Compound Name | 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-1-[3-(trifluoromethyl)anilino]urea |
|---|---|
| PubChem CID | 68887828 |
| Molecular Formula | C20H15F3N6O |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-1-[3-(trifluoromethyl)anilino]urea |
| SMILES | NC(=O)N(Nc1cccc(C(F)(F)F)c1)c1cccc(C#Cc2cnc(N)nc2)c1 |
| InChI | InChI=1S/C20H15F3N6O/c21-20(22,23)15-4-2-5-16(10-15)28-29(19(25)30)17-6-1-3-13(9-17)7-8-14-11-26-18(24)27-12-14/h1-6,9-12,28H,(H2,25,30)(H2,24,26,27) |
| InChIKey | OSZSVZDLZVUJPI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|