C21H22N6O2 — CID 69158874
1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methylurea (PubChem CID 69158874) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methylurea.
| Compound Name | 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methylurea |
|---|---|
| PubChem CID | 69158874 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methylurea |
| SMILES | CN(C(=O)Nc1cc(C(C)(C)C)on1)c1cccc(C#Cc2cnc(N)nc2)c1 |
| InChI | InChI=1S/C21H22N6O2/c1-21(2,3)17-11-18(26-29-17)25-20(28)27(4)16-7-5-6-14(10-16)8-9-15-12-23-19(22)24-13-15/h5-7,10-13H,1-4H3,(H2,22,23,24)(H,25,26,28) |
| InChIKey | ZDBDVDOARCQYRM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|