C13H9ClF3N3O — CID 114921483
2-amino-5-chloro-N-[3-(trifluoromethyl)phenyl]pyridine-4-carboxamide (PubChem CID 114921483) has the molecular formula C13H9ClF3N3O and a molecular weight of 315.68 g/mol. Its IUPAC name is 2-amino-5-chloro-N-[3-(trifluoromethyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-amino-5-chloro-N-[3-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114921483 |
| Molecular Formula | C13H9ClF3N3O |
| Molecular Weight | 315.68 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-amino-5-chloro-N-[3-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
| SMILES | Nc1cc(C(=O)Nc2cccc(C(F)(F)F)c2)c(Cl)cn1 |
| InChI | InChI=1S/C13H9ClF3N3O/c14-10-6-19-11(18)5-9(10)12(21)20-8-3-1-2-7(4-8)13(15,16)17/h1-6H,(H2,18,19)(H,20,21) |
| InChIKey | QXHTZRAEWSHJOT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.68 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |